C12H12F5NO2 — CID 106658935
2,2-dimethyl-N-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxan-5-amine (PubChem CID 106658935) has the molecular formula C12H12F5NO2 and a molecular weight of 297.22 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxan-5-amine.
| Compound Name | 2,2-dimethyl-N-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 106658935 |
| Molecular Formula | C12H12F5NO2 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2,2-dimethyl-N-(2,3,4,5,6-pentafluorophenyl)-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(Nc2c(F)c(F)c(F)c(F)c2F)CO1 |
| InChI | InChI=1S/C12H12F5NO2/c1-12(2)19-3-5(4-20-12)18-11-9(16)7(14)6(13)8(15)10(11)17/h5,18H,3-4H2,1-2H3 |
| InChIKey | MXQNBFLPHNANPS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|