C13H16F3NO3 — CID 106658612
N-[4-(difluoromethoxy)-3-fluorophenyl]-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 106658612) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-fluorophenyl]-2,2-dimethyl-1,3-dioxan-5-amine.
| Compound Name | N-[4-(difluoromethoxy)-3-fluorophenyl]-2,2-dimethyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 106658612 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-fluorophenyl]-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(Nc2ccc(OC(F)F)c(F)c2)CO1 |
| InChI | InChI=1S/C13H16F3NO3/c1-13(2)18-6-9(7-19-13)17-8-3-4-11(10(14)5-8)20-12(15)16/h3-5,9,12,17H,6-7H2,1-2H3 |
| InChIKey | GJSIYHUIUCXELM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|