C14H17N3O4 — CID 106658413
6-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 106658413) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 6-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 106658413 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 6-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CC1(C)OCC(Nc2ccc3[nH]c(=O)c(=O)[nH]c3c2)CO1 |
| InChI | InChI=1S/C14H17N3O4/c1-14(2)20-6-9(7-21-14)15-8-3-4-10-11(5-8)17-13(19)12(18)16-10/h3-5,9,15H,6-7H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | ZQUUBDRDFNIDBK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|