C15H20N2O4 — CID 106658287
6-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 106658287) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 6-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 106658287 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 6-[(2,2-dimethyl-1,3-dioxan-5-yl)amino]-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(NC3COC(C)(C)OC3)cc2NC1=O |
| InChI | InChI=1S/C15H20N2O4/c1-9-14(18)17-12-6-10(4-5-13(12)21-9)16-11-7-19-15(2,3)20-8-11/h4-6,9,11,16H,7-8H2,1-3H3,(H,17,18) |
| InChIKey | OUIFTXYDWKYFRS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|