C11H14N2O3 — CID 82494411
6-(2-hydroxyethylamino)-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 82494411) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 6-(2-hydroxyethylamino)-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-hydroxyethylamino)-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82494411 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 6-(2-hydroxyethylamino)-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(NCCO)cc2NC1=O |
| InChI | InChI=1S/C11H14N2O3/c1-7-11(15)13-9-6-8(12-4-5-14)2-3-10(9)16-7/h2-3,6-7,12,14H,4-5H2,1H3,(H,13,15) |
| InChIKey | XVDJKWFPZCHZQV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|