C12H13N3O4S — CID 63162940
6-[(1,1-dioxothiolan-3-yl)amino]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 63162940) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 6-[(1,1-dioxothiolan-3-yl)amino]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[(1,1-dioxothiolan-3-yl)amino]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 63162940 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 6-[(1,1-dioxothiolan-3-yl)amino]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(NC3CCS(=O)(=O)C3)cc2[nH]c1=O |
| InChI | InChI=1S/C12H13N3O4S/c16-11-12(17)15-10-5-7(1-2-9(10)14-11)13-8-3-4-20(18,19)6-8/h1-2,5,8,13H,3-4,6H2,(H,14,16)(H,15,17) |
| InChIKey | XJZCOCJOCYIXIZ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|