C11H11ClN2O2S — CID 43348079
2-chloro-4-[(1,1-dioxothiolan-3-yl)amino]benzonitrile (PubChem CID 43348079) has the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. Its IUPAC name is 2-chloro-4-[(1,1-dioxothiolan-3-yl)amino]benzonitrile.
| Compound Name | 2-chloro-4-[(1,1-dioxothiolan-3-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 43348079 |
| Molecular Formula | C11H11ClN2O2S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 2-chloro-4-[(1,1-dioxothiolan-3-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(NC2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C11H11ClN2O2S/c12-11-5-9(2-1-8(11)6-13)14-10-3-4-17(15,16)7-10/h1-2,5,10,14H,3-4,7H2 |
| InChIKey | CBLASAUFNVVALM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |