C12H15NO4S — CID 7116120
N-[(3R)-1,1-dioxothiolan-3-yl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 7116120) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 7116120 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | O=S1(=O)CC[C@@H](Nc2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C12H15NO4S/c14-18(15)6-3-10(8-18)13-9-1-2-11-12(7-9)17-5-4-16-11/h1-2,7,10,13H,3-6,8H2/t10-/m1/s1 |
| InChIKey | XKLBSEMMYNIQTJ-SNVBAGLBSA-N |
| XLogP | 1.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|