C11H16N2O3S — CID 55232141
4-N-(1,1-dioxothiolan-3-yl)-2-methoxybenzene-1,4-diamine (PubChem CID 55232141) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-2-methoxybenzene-1,4-diamine.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-2-methoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 55232141 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-2-methoxybenzene-1,4-diamine |
| SMILES | COc1cc(NC2CCS(=O)(=O)C2)ccc1N |
| InChI | InChI=1S/C11H16N2O3S/c1-16-11-6-8(2-3-10(11)12)13-9-4-5-17(14,15)7-9/h2-3,6,9,13H,4-5,7,12H2,1H3 |
| InChIKey | CZXBBYZKADMWNN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|