C12H18N2O3S — CID 63678149
2-methoxy-4-N-(3-methyl-1,1-dioxothiolan-3-yl)benzene-1,4-diamine (PubChem CID 63678149) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-methoxy-4-N-(3-methyl-1,1-dioxothiolan-3-yl)benzene-1,4-diamine.
| Compound Name | 2-methoxy-4-N-(3-methyl-1,1-dioxothiolan-3-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63678149 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-methoxy-4-N-(3-methyl-1,1-dioxothiolan-3-yl)benzene-1,4-diamine |
| SMILES | COc1cc(NC2(C)CCS(=O)(=O)C2)ccc1N |
| InChI | InChI=1S/C12H18N2O3S/c1-12(5-6-18(15,16)8-12)14-9-3-4-10(13)11(7-9)17-2/h3-4,7,14H,5-6,8,13H2,1-2H3 |
| InChIKey | GFXKKPSPGIJVNN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|