C12H15FN2O2S2 — CID 115368199
2-fluoro-4-[(3-methyl-1,1-dioxothiolan-3-yl)amino]benzenecarbothioamide (PubChem CID 115368199) has the molecular formula C12H15FN2O2S2 and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-fluoro-4-[(3-methyl-1,1-dioxothiolan-3-yl)amino]benzenecarbothioamide.
| Compound Name | 2-fluoro-4-[(3-methyl-1,1-dioxothiolan-3-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 115368199 |
| Molecular Formula | C12H15FN2O2S2 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-fluoro-4-[(3-methyl-1,1-dioxothiolan-3-yl)amino]benzenecarbothioamide |
| SMILES | CC1(Nc2ccc(C(N)=S)c(F)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15FN2O2S2/c1-12(4-5-19(16,17)7-12)15-8-2-3-9(11(14)18)10(13)6-8/h2-3,6,15H,4-5,7H2,1H3,(H2,14,18) |
| InChIKey | OXFNVZZVUVKKNS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|