C13H18N2O2S2 — CID 107928832
5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]benzenecarbothioamide (PubChem CID 107928832) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]benzenecarbothioamide.
| Compound Name | 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107928832 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-methyl-2-[(3-methyl-1,1-dioxothiolan-3-yl)amino]benzenecarbothioamide |
| SMILES | Cc1ccc(NC2(C)CCS(=O)(=O)C2)c(C(N)=S)c1 |
| InChI | InChI=1S/C13H18N2O2S2/c1-9-3-4-11(10(7-9)12(14)18)15-13(2)5-6-19(16,17)8-13/h3-4,7,15H,5-6,8H2,1-2H3,(H2,14,18) |
| InChIKey | HQBVSGFDSMPOMW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|