C16H18N2O2S2 — CID 7100843
1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-naphthalen-2-ylthiourea (PubChem CID 7100843) has the molecular formula C16H18N2O2S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-naphthalen-2-ylthiourea.
| Compound Name | 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-naphthalen-2-ylthiourea |
|---|---|
| PubChem CID | 7100843 |
| Molecular Formula | C16H18N2O2S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-naphthalen-2-ylthiourea |
| SMILES | C[C@]1(NC(=S)Nc2ccc3ccccc3c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18N2O2S2/c1-16(8-9-22(19,20)11-16)18-15(21)17-14-7-6-12-4-2-3-5-13(12)10-14/h2-7,10H,8-9,11H2,1H3,(H2,17,18,21)/t16-/m0/s1 |
| InChIKey | PBYDVOJPMHDHHT-INIZCTEOSA-N |
| XLogP | 2.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|