About O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate
O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate (PubChem CID 102566965) has the molecular formula C12H14BrNO3S2
and a molecular weight of 364.29 g/mol. Its IUPAC name is O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate.
Molecular Properties
| Compound Name | O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate |
| PubChem CID | 102566965 |
| Molecular Formula | C12H14BrNO3S2 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate |
| SMILES | CC1(NC(=S)Oc2ccccc2Br)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14BrNO3S2/c1-12(6-7-19(15,16)8-12)14-11(18)17-10-5-3-2-4-9(10)13/h2-5H,6-8H2,1H3,(H,14,18) |
| InChIKey | KBOSWSODZUSSNP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate?
The IUPAC name of O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate (CID 102566965) is O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate.
What is the SMILES notation for O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate?
The canonical SMILES for O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate is CC1(NC(=S)Oc2ccccc2Br)CCS(=O)(=O)C1.
What is the InChIKey of O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate?
The InChIKey is KBOSWSODZUSSNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO3S2/c1-12(6-7-19(15,16)8-12)14-11(18)17-10-5-3-2-4-9(10)13/h2-5H,6-8H2,1H3,(H,14,18).
What are the key properties of O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate?
O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate has a molecular weight of 364.29 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-bromophenyl) N-(3-methyl-1,1-dioxothiolan-3-yl)carbamothioate is sourced from PubChem (CID 102566965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).