C6H11NO2S3 — CID 7058895
[(3R)-3-methyl-1,1-dioxothiolan-3-yl]carbamodithioic acid (PubChem CID 7058895) has the molecular formula C6H11NO2S3 and a molecular weight of 225.36 g/mol. Its IUPAC name is [(3R)-3-methyl-1,1-dioxothiolan-3-yl]carbamodithioic acid.
| Compound Name | [(3R)-3-methyl-1,1-dioxothiolan-3-yl]carbamodithioic acid |
|---|---|
| PubChem CID | 7058895 |
| Molecular Formula | C6H11NO2S3 |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | [(3R)-3-methyl-1,1-dioxothiolan-3-yl]carbamodithioic acid |
| SMILES | C[C@@]1(NC(=S)S)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H11NO2S3/c1-6(7-5(10)11)2-3-12(8,9)4-6/h2-4H2,1H3,(H2,7,10,11)/t6-/m1/s1 |
| InChIKey | OZJBYUXVHGAJEP-ZCFIWIBFSA-N |
| XLogP | 0.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|