C12H20N2O4S6 — CID 51496111
[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamothioylsulfanyl N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamodithioate (PubChem CID 51496111) has the molecular formula C12H20N2O4S6 and a molecular weight of 448.70 g/mol. Its IUPAC name is [(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamothioylsulfanyl N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamodithioate.
| Compound Name | [(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamothioylsulfanyl N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamodithioate |
|---|---|
| PubChem CID | 51496111 |
| Molecular Formula | C12H20N2O4S6 |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | [(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamothioylsulfanyl N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamodithioate |
| SMILES | C[C@]1(NC(=S)SSC(=S)N[C@@]2(C)CCS(=O)(=O)C2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20N2O4S6/c1-11(3-5-23(15,16)7-11)13-9(19)21-22-10(20)14-12(2)4-6-24(17,18)8-12/h3-8H2,1-2H3,(H,13,19)(H,14,20)/t11-,12-/m0/s1 |
| InChIKey | WCXMGOYWIPEICD-RYUDHWBXSA-N |
| XLogP | 1.27 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|