C8H15NO3S2 — CID 107027169
N-(3-methyl-1,1-dioxothiolan-3-yl)-2-sulfanylpropanamide (PubChem CID 107027169) has the molecular formula C8H15NO3S2 and a molecular weight of 237.35 g/mol. Its IUPAC name is N-(3-methyl-1,1-dioxothiolan-3-yl)-2-sulfanylpropanamide.
| Compound Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107027169 |
| Molecular Formula | C8H15NO3S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-2-sulfanylpropanamide |
| SMILES | CC(S)C(=O)NC1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO3S2/c1-6(13)7(10)9-8(2)3-4-14(11,12)5-8/h6,13H,3-5H2,1-2H3,(H,9,10) |
| InChIKey | CWCQUQQZTCYPCB-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|