C10H20N2O3S — CID 3436222
1-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropyl)urea (PubChem CID 3436222) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropyl)urea.
| Compound Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 3436222 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-(2-methylpropyl)urea |
| SMILES | CC(C)CNC(=O)NC1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H20N2O3S/c1-8(2)6-11-9(13)12-10(3)4-5-16(14,15)7-10/h8H,4-7H2,1-3H3,(H2,11,12,13) |
| InChIKey | ATKVIIYVTZIEPA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |