C13H18N2O3S2 — CID 51414995
1-(2-methoxyphenyl)-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]thiourea (PubChem CID 51414995) has the molecular formula C13H18N2O3S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]thiourea |
|---|---|
| PubChem CID | 51414995 |
| Molecular Formula | C13H18N2O3S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]thiourea |
| SMILES | COc1ccccc1NC(=S)N[C@]1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18N2O3S2/c1-13(7-8-20(16,17)9-13)15-12(19)14-10-5-3-4-6-11(10)18-2/h3-6H,7-9H2,1-2H3,(H2,14,15,19)/t13-/m1/s1 |
| InChIKey | JFYAYRBROWLFDM-CYBMUJFWSA-N |
| XLogP | 1.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|