C19H22N2O6S2 — CID 30583256
4-[(2-methoxyphenyl)sulfamoyl]-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 30583256) has the molecular formula C19H22N2O6S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)sulfamoyl]-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 4-[(2-methoxyphenyl)sulfamoyl]-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 30583256 |
| Molecular Formula | C19H22N2O6S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 4-[(2-methoxyphenyl)sulfamoyl]-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(C(=O)N[C@]2(C)CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H22N2O6S2/c1-19(11-12-28(23,24)13-19)20-18(22)14-7-9-15(10-8-14)29(25,26)21-16-5-3-4-6-17(16)27-2/h3-10,21H,11-13H2,1-2H3,(H,20,22)/t19-/m1/s1 |
| InChIKey | HPVRZDHCWIDFPQ-LJQANCHMSA-N |
| XLogP | 1.80 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |