C12H17NO4S — CID 63166531
[3-(2-methoxyanilino)-1,1-dioxothiolan-3-yl]methanol (PubChem CID 63166531) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is [3-(2-methoxyanilino)-1,1-dioxothiolan-3-yl]methanol.
| Compound Name | [3-(2-methoxyanilino)-1,1-dioxothiolan-3-yl]methanol |
|---|---|
| PubChem CID | 63166531 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [3-(2-methoxyanilino)-1,1-dioxothiolan-3-yl]methanol |
| SMILES | COc1ccccc1NC1(CO)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17NO4S/c1-17-11-5-3-2-4-10(11)13-12(8-14)6-7-18(15,16)9-12/h2-5,13-14H,6-9H2,1H3 |
| InChIKey | FDZKDXBNCSOAKM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |