C12H16N2O4S — CID 63166159
3-(2-methoxyanilino)-1,1-dioxothiolane-3-carboxamide (PubChem CID 63166159) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-(2-methoxyanilino)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | 3-(2-methoxyanilino)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 63166159 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-(2-methoxyanilino)-1,1-dioxothiolane-3-carboxamide |
| SMILES | COc1ccccc1NC1(C(N)=O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H16N2O4S/c1-18-10-5-3-2-4-9(10)14-12(11(13)15)6-7-19(16,17)8-12/h2-5,14H,6-8H2,1H3,(H2,13,15) |
| InChIKey | MBGLGGIOJHMRBJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |