C11H13FN2O3S — CID 63166201
3-(2-fluoroanilino)-1,1-dioxothiolane-3-carboxamide (PubChem CID 63166201) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-(2-fluoroanilino)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | 3-(2-fluoroanilino)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 63166201 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-(2-fluoroanilino)-1,1-dioxothiolane-3-carboxamide |
| SMILES | NC(=O)C1(Nc2ccccc2F)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13FN2O3S/c12-8-3-1-2-4-9(8)14-11(10(13)15)5-6-18(16,17)7-11/h1-4,14H,5-7H2,(H2,13,15) |
| InChIKey | CLESAOKCMSTNLT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |