C10H14N2O3S2 — CID 63166290
1,1-dioxo-3-(thiophen-2-ylmethylamino)thiolane-3-carboxamide (PubChem CID 63166290) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 1,1-dioxo-3-(thiophen-2-ylmethylamino)thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-3-(thiophen-2-ylmethylamino)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 63166290 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1,1-dioxo-3-(thiophen-2-ylmethylamino)thiolane-3-carboxamide |
| SMILES | NC(=O)C1(NCc2cccs2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H14N2O3S2/c11-9(13)10(3-5-17(14,15)7-10)12-6-8-2-1-4-16-8/h1-2,4,12H,3,5-7H2,(H2,11,13) |
| InChIKey | VHBAQMZUFSGVAD-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |