C16H23NO2S — CID 114818394
8-(thiophen-2-ylmethylamino)spiro[4.5]decane-8-carboxylic acid (PubChem CID 114818394) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 8-(thiophen-2-ylmethylamino)spiro[4.5]decane-8-carboxylic acid.
| Compound Name | 8-(thiophen-2-ylmethylamino)spiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 114818394 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 8-(thiophen-2-ylmethylamino)spiro[4.5]decane-8-carboxylic acid |
| SMILES | O=C(O)C1(NCc2cccs2)CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C16H23NO2S/c18-14(19)16(17-12-13-4-3-11-20-13)9-7-15(8-10-16)5-1-2-6-15/h3-4,11,17H,1-2,5-10,12H2,(H,18,19) |
| InChIKey | KQMPNRGMAIZOKG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |