C13H15FNO2- — CID 7158135
1-(2-fluoroanilino)cyclohexane-1-carboxylate (PubChem CID 7158135) has the molecular formula C13H15FNO2- and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-(2-fluoroanilino)cyclohexane-1-carboxylate.
| Compound Name | 1-(2-fluoroanilino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7158135 |
| Molecular Formula | C13H15FNO2- |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1-(2-fluoroanilino)cyclohexane-1-carboxylate |
| SMILES | O=C([O-])C1(Nc2ccccc2F)CCCCC1 |
| InChI | InChI=1S/C13H16FNO2/c14-10-6-2-3-7-11(10)15-13(12(16)17)8-4-1-5-9-13/h2-3,6-7,15H,1,4-5,8-9H2,(H,16,17)/p-1 |
| InChIKey | ZKXKMSMSLQWXHE-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |