C15H22N2O4S — CID 30705980
2-(2-ethoxyanilino)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 30705980) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-(2-ethoxyanilino)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(2-ethoxyanilino)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 30705980 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(2-ethoxyanilino)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CCOc1ccccc1NCC(=O)N[C@]1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H22N2O4S/c1-3-21-13-7-5-4-6-12(13)16-10-14(18)17-15(2)8-9-22(19,20)11-15/h4-7,16H,3,8-11H2,1-2H3,(H,17,18)/t15-/m1/s1 |
| InChIKey | LLAZBPGZEIGHIZ-OAHLLOKOSA-N |
| XLogP | 1.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |