C12H14ClN3O4S2 — CID 7945369
1-(2-chloro-5-nitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]thiourea (PubChem CID 7945369) has the molecular formula C12H14ClN3O4S2 and a molecular weight of 363.85 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]thiourea.
| Compound Name | 1-(2-chloro-5-nitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]thiourea |
|---|---|
| PubChem CID | 7945369 |
| Molecular Formula | C12H14ClN3O4S2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]thiourea |
| SMILES | C[C@]1(NC(=S)Nc2cc([N+](=O)[O-])ccc2Cl)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14ClN3O4S2/c1-12(4-5-22(19,20)7-12)15-11(21)14-10-6-8(16(17)18)2-3-9(10)13/h2-3,6H,4-5,7H2,1H3,(H2,14,15,21)/t12-/m0/s1 |
| InChIKey | BNVBFSFZKSDOGF-LBPRGKRZSA-N |
| XLogP | 2.11 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|