C15H15ClN4O2S — CID 8786441
1-(2-chloro-5-nitrophenyl)-3-(3,5-dimethylanilino)thiourea (PubChem CID 8786441) has the molecular formula C15H15ClN4O2S and a molecular weight of 350.83 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)-3-(3,5-dimethylanilino)thiourea.
| Compound Name | 1-(2-chloro-5-nitrophenyl)-3-(3,5-dimethylanilino)thiourea |
|---|---|
| PubChem CID | 8786441 |
| Molecular Formula | C15H15ClN4O2S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)-3-(3,5-dimethylanilino)thiourea |
| SMILES | Cc1cc(C)cc(NNC(=S)Nc2cc([N+](=O)[O-])ccc2Cl)c1 |
| InChI | InChI=1S/C15H15ClN4O2S/c1-9-5-10(2)7-11(6-9)18-19-15(23)17-14-8-12(20(21)22)3-4-13(14)16/h3-8,18H,1-2H3,(H2,17,19,23) |
| InChIKey | WZXDBBFMTWJLMC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|