C16H14F3N3O2S — CID 19687540
1-(3,5-dimethylphenyl)-3-[4-nitro-2-(trifluoromethyl)phenyl]thiourea (PubChem CID 19687540) has the molecular formula C16H14F3N3O2S and a molecular weight of 369.37 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[4-nitro-2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[4-nitro-2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19687540 |
| Molecular Formula | C16H14F3N3O2S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[4-nitro-2-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)Nc2ccc([N+](=O)[O-])cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3N3O2S/c1-9-5-10(2)7-11(6-9)20-15(25)21-14-4-3-12(22(23)24)8-13(14)16(17,18)19/h3-8H,1-2H3,(H2,20,21,25) |
| InChIKey | QDJSIQOZBLKBPT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|