C14H8F3N3O6 — CID 141401924
2-hydroxy-5-nitro-N-[4-nitro-2-(trifluoromethyl)phenyl]benzamide (PubChem CID 141401924) has the molecular formula C14H8F3N3O6 and a molecular weight of 371.23 g/mol. Its IUPAC name is 2-hydroxy-5-nitro-N-[4-nitro-2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-hydroxy-5-nitro-N-[4-nitro-2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 141401924 |
| Molecular Formula | C14H8F3N3O6 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 2-hydroxy-5-nitro-N-[4-nitro-2-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1C(F)(F)F)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C14H8F3N3O6/c15-14(16,17)10-6-8(20(25)26)1-3-11(10)18-13(22)9-5-7(19(23)24)2-4-12(9)21/h1-6,21H,(H,18,22) |
| InChIKey | HMAQDCPOVSTOSV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|