C26H15F7N4O7 — CID 161450326
2-fluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]benzamide;N-[4-nitro-2-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 161450326) has the molecular formula C26H15F7N4O7 and a molecular weight of 628.41 g/mol. Its IUPAC name is 2-fluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]benzamide;N-[4-nitro-2-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | 2-fluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]benzamide;N-[4-nitro-2-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 161450326 |
| Molecular Formula | C26H15F7N4O7 |
| Molecular Weight | 628.41 g/mol |
| Exact Mass | 628.08 |
| IUPAC Name | 2-fluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]benzamide;N-[4-nitro-2-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1C(F)(F)F)c1ccccc1F.O=C(Nc1ccc([N+](=O)[O-])cc1C(F)(F)F)c1ccco1 |
| InChI | InChI=1S/C14H8F4N2O3.C12H7F3N2O4/c15-11-4-2-1-3-9(11)13(21)19-12-6-5-8(20(22)23)7-10(12)14(16,17)18;13-12(14,15)8-6-7(17(19)20)3-4-9(8)16-11(18)10-2-1-5-21-10/h1-7H,(H,19,21);1-6H,(H,16,18) |
| InChIKey | WALFRBMIBYYWTF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.41 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|