C26H19Cl2FN4O7 — CID 158719874
N-(5-chloro-2-methyl-4-nitrophenyl)-2-fluorobenzamide;N-(5-chloro-2-methyl-4-nitrophenyl)furan-2-carboxamide (PubChem CID 158719874) has the molecular formula C26H19Cl2FN4O7 and a molecular weight of 589.36 g/mol. Its IUPAC name is N-(5-chloro-2-methyl-4-nitrophenyl)-2-fluorobenzamide;N-(5-chloro-2-methyl-4-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-(5-chloro-2-methyl-4-nitrophenyl)-2-fluorobenzamide;N-(5-chloro-2-methyl-4-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 158719874 |
| Molecular Formula | C26H19Cl2FN4O7 |
| Molecular Weight | 589.36 g/mol |
| Exact Mass | 588.06 |
| IUPAC Name | N-(5-chloro-2-methyl-4-nitrophenyl)-2-fluorobenzamide;N-(5-chloro-2-methyl-4-nitrophenyl)furan-2-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1NC(=O)c1ccccc1F.Cc1cc([N+](=O)[O-])c(Cl)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C14H10ClFN2O3.C12H9ClN2O4/c1-8-6-13(18(20)21)10(15)7-12(8)17-14(19)9-4-2-3-5-11(9)16;1-7-5-10(15(17)18)8(13)6-9(7)14-12(16)11-3-2-4-19-11/h2-7H,1H3,(H,17,19);2-6H,1H3,(H,14,16) |
| InChIKey | IJTXPHNJKRLDEP-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.36 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|