C13H8Cl2N2O4 — CID 71312570
5-chloro-N-(2-chloro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-hydroxybenzamide (PubChem CID 71312570) has the molecular formula C13H8Cl2N2O4 and a molecular weight of 333.08 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-hydroxybenzamide.
| Compound Name | 5-chloro-N-(2-chloro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 71312570 |
| Molecular Formula | C13H8Cl2N2O4 |
| Molecular Weight | 333.08 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 5-chloro-N-(2-chloro-4-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-hydroxybenzamide |
| SMILES | O=C(N[13c]1[13cH][13cH][13c]([N+](=O)[O-])[13cH][13c]1Cl)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h1-6,18H,(H,16,19)/i2+1,3+1,6+1,8+1,10+1,11+1 |
| InChIKey | RJMUSRYZPJIFPJ-WWNCZKIWSA-N |
| XLogP | 3.86 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.08 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|