C15H11ClN2O4 — CID 163370469
N-(2-chloro-4-nitrophenyl)-5-ethenyl-2-hydroxybenzamide (PubChem CID 163370469) has the molecular formula C15H11ClN2O4 and a molecular weight of 318.72 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-5-ethenyl-2-hydroxybenzamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-5-ethenyl-2-hydroxybenzamide |
|---|---|
| PubChem CID | 163370469 |
| Molecular Formula | C15H11ClN2O4 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-5-ethenyl-2-hydroxybenzamide |
| SMILES | C=Cc1ccc(O)c(C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)c1 |
| InChI | InChI=1S/C15H11ClN2O4/c1-2-9-3-6-14(19)11(7-9)15(20)17-13-5-4-10(18(21)22)8-12(13)16/h2-8,19H,1H2,(H,17,20) |
| InChIKey | SJIGUHIPJRLWCN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|