C23H16ClN3O7 — CID 10322967
(E)-2-benzamido-3-[3-[(2-chloro-4-nitrophenyl)carbamoyl]-4-hydroxyphenyl]prop-2-enoic acid (PubChem CID 10322967) has the molecular formula C23H16ClN3O7 and a molecular weight of 481.85 g/mol. Its IUPAC name is (E)-2-benzamido-3-[3-[(2-chloro-4-nitrophenyl)carbamoyl]-4-hydroxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-2-benzamido-3-[3-[(2-chloro-4-nitrophenyl)carbamoyl]-4-hydroxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10322967 |
| Molecular Formula | C23H16ClN3O7 |
| Molecular Weight | 481.85 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | (E)-2-benzamido-3-[3-[(2-chloro-4-nitrophenyl)carbamoyl]-4-hydroxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc(O)c(C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H16ClN3O7/c24-17-12-15(27(33)34)7-8-18(17)25-22(30)16-10-13(6-9-20(16)28)11-19(23(31)32)26-21(29)14-4-2-1-3-5-14/h1-12,28H,(H,25,30)(H,26,29)(H,31,32)/b19-11+ |
| InChIKey | BJDZTJQMVFUKHP-YBFXNURJSA-N |
| XLogP | 4.06 |
| TPSA | 158.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.85 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|