C22H15ClN2O6 — CID 22148253
(E)-2-benzamido-3-[3-(2-chloro-4-nitrophenoxy)phenyl]prop-2-enoic acid (PubChem CID 22148253) has the molecular formula C22H15ClN2O6 and a molecular weight of 438.82 g/mol. Its IUPAC name is (E)-2-benzamido-3-[3-(2-chloro-4-nitrophenoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-benzamido-3-[3-(2-chloro-4-nitrophenoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22148253 |
| Molecular Formula | C22H15ClN2O6 |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | (E)-2-benzamido-3-[3-(2-chloro-4-nitrophenoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1cccc(Oc2ccc([N+](=O)[O-])cc2Cl)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H15ClN2O6/c23-18-13-16(25(29)30)9-10-20(18)31-17-8-4-5-14(11-17)12-19(22(27)28)24-21(26)15-6-2-1-3-7-15/h1-13H,(H,24,26)(H,27,28)/b19-12+ |
| InChIKey | SQNAYTNJPORBQH-XDHOZWIPSA-N |
| XLogP | 4.90 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|