C9H8F3N3O3 — CID 54935573
2-[4-nitro-2-(trifluoromethyl)anilino]acetamide (PubChem CID 54935573) has the molecular formula C9H8F3N3O3 and a molecular weight of 263.17 g/mol. Its IUPAC name is 2-[4-nitro-2-(trifluoromethyl)anilino]acetamide.
| Compound Name | 2-[4-nitro-2-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 54935573 |
| Molecular Formula | C9H8F3N3O3 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-[4-nitro-2-(trifluoromethyl)anilino]acetamide |
| SMILES | NC(=O)CNc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C9H8F3N3O3/c10-9(11,12)6-3-5(15(17)18)1-2-7(6)14-4-8(13)16/h1-3,14H,4H2,(H2,13,16) |
| InChIKey | IEIZPJBDBFFLIT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|