C13H17F3N2O2 — CID 104828660
N-(3,3-dimethylbutan-2-yl)-4-nitro-2-(trifluoromethyl)aniline (PubChem CID 104828660) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-4-nitro-2-(trifluoromethyl)aniline.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-4-nitro-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 104828660 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-4-nitro-2-(trifluoromethyl)aniline |
| SMILES | CC(Nc1ccc([N+](=O)[O-])cc1C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C13H17F3N2O2/c1-8(12(2,3)4)17-11-6-5-9(18(19)20)7-10(11)13(14,15)16/h5-8,17H,1-4H3 |
| InChIKey | VBSOIFXJBIHXBF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|