C10H11F3N2O4S — CID 60925778
N-(2-methylsulfonylethyl)-4-nitro-2-(trifluoromethyl)aniline (PubChem CID 60925778) has the molecular formula C10H11F3N2O4S and a molecular weight of 312.27 g/mol. Its IUPAC name is N-(2-methylsulfonylethyl)-4-nitro-2-(trifluoromethyl)aniline.
| Compound Name | N-(2-methylsulfonylethyl)-4-nitro-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 60925778 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-(2-methylsulfonylethyl)-4-nitro-2-(trifluoromethyl)aniline |
| SMILES | CS(=O)(=O)CCNc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O4S/c1-20(18,19)5-4-14-9-3-2-7(15(16)17)6-8(9)10(11,12)13/h2-3,6,14H,4-5H2,1H3 |
| InChIKey | JVVQIDSWKOANPD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|