C12H14N4O7S — CID 51496110
1-(2,4-dinitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea (PubChem CID 51496110) has the molecular formula C12H14N4O7S and a molecular weight of 358.33 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-(2,4-dinitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 51496110 |
| Molecular Formula | C12H14N4O7S |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-3-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]urea |
| SMILES | C[C@]1(NC(=O)Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14N4O7S/c1-12(4-5-24(22,23)7-12)14-11(17)13-9-3-2-8(15(18)19)6-10(9)16(20)21/h2-3,6H,4-5,7H2,1H3,(H2,13,14,17)/t12-/m0/s1 |
| InChIKey | QJRAILVUXQRTBF-LBPRGKRZSA-N |
| XLogP | 1.20 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|