C12H13FN2O5S — CID 62681284
3-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-nitrobenzamide (PubChem CID 62681284) has the molecular formula C12H13FN2O5S and a molecular weight of 316.31 g/mol. Its IUPAC name is 3-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-nitrobenzamide.
| Compound Name | 3-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 62681284 |
| Molecular Formula | C12H13FN2O5S |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 3-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-nitrobenzamide |
| SMILES | CC1(NC(=O)c2ccc([N+](=O)[O-])c(F)c2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13FN2O5S/c1-12(4-5-21(19,20)7-12)14-11(16)8-2-3-10(15(17)18)9(13)6-8/h2-3,6H,4-5,7H2,1H3,(H,14,16) |
| InChIKey | JLXDSVDAZWXQIV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|