C12H15N3O4S2 — CID 3753811
1-(3-methyl-1,1-dioxothiolan-3-yl)-3-(4-nitrophenyl)thiourea (PubChem CID 3753811) has the molecular formula C12H15N3O4S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 3753811 |
| Molecular Formula | C12H15N3O4S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-(4-nitrophenyl)thiourea |
| SMILES | CC1(NC(=S)Nc2ccc([N+](=O)[O-])cc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15N3O4S2/c1-12(6-7-21(18,19)8-12)14-11(20)13-9-2-4-10(5-3-9)15(16)17/h2-5H,6-8H2,1H3,(H2,13,14,20) |
| InChIKey | GZRBSWJWPKMWFQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|