C11H11N3O4S2 — CID 43827987
1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-3-(4-nitrophenyl)thiourea (PubChem CID 43827987) has the molecular formula C11H11N3O4S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 43827987 |
| Molecular Formula | C11H11N3O4S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 1-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-3-(4-nitrophenyl)thiourea |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)NC2=CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C11H11N3O4S2/c15-14(16)10-3-1-8(2-4-10)12-11(19)13-9-5-6-20(17,18)7-9/h1-5H,6-7H2,(H2,12,13,19) |
| InChIKey | RWGLOSPQVRACEQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|