C15H21N5OS — CID 750295
1-(2-methoxyphenyl)-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)thiourea (PubChem CID 750295) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)thiourea |
|---|---|
| PubChem CID | 750295 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)thiourea |
| SMILES | COc1ccccc1NC(=S)NC12CN3CN(CN(C3)C1)C2 |
| InChI | InChI=1S/C15H21N5OS/c1-21-13-5-3-2-4-12(13)16-14(22)17-15-6-18-9-19(7-15)11-20(8-15)10-18/h2-5H,6-11H2,1H3,(H2,16,17,22) |
| InChIKey | XFMKOOBWYMYMTB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 43.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|