C23H27N5OS — CID 6021261
1-(2-methoxyphenyl)-3-[(Z)-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]thiourea (PubChem CID 6021261) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[(Z)-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-[(Z)-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 6021261 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[(Z)-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]thiourea |
| SMILES | COc1ccccc1NC(=S)N/N=C1/C2CN3CCN(C2)CC1(c1ccccc1)C3 |
| InChI | InChI=1S/C23H27N5OS/c1-29-20-10-6-5-9-19(20)24-22(30)26-25-21-17-13-27-11-12-28(14-17)16-23(21,15-27)18-7-3-2-4-8-18/h2-10,17H,11-16H2,1H3,(H2,24,26,30)/b25-21- |
| InChIKey | OZQRHBJZLVHTBP-DAFNUICNSA-N |
| XLogP | 2.54 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|