C16H17N3O2S — CID 2404947
1-(2-methoxyphenyl)-3-[(2-methoxyphenyl)methylideneamino]thiourea (PubChem CID 2404947) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[(2-methoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-[(2-methoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 2404947 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[(2-methoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1ccccc1C=NNC(=S)Nc1ccccc1OC |
| InChI | InChI=1S/C16H17N3O2S/c1-20-14-9-5-3-7-12(14)11-17-19-16(22)18-13-8-4-6-10-15(13)21-2/h3-11H,1-2H3,(H2,18,19,22) |
| InChIKey | NREXPRJLYQVTJG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|