C17H16N4OS — CID 135683948
1-[(E)-1H-indol-3-ylmethylideneamino]-3-(2-methoxyphenyl)thiourea (PubChem CID 135683948) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-[(E)-1H-indol-3-ylmethylideneamino]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[(E)-1H-indol-3-ylmethylideneamino]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 135683948 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-[(E)-1H-indol-3-ylmethylideneamino]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)N/N=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H16N4OS/c1-22-16-9-5-4-8-15(16)20-17(23)21-19-11-12-10-18-14-7-3-2-6-13(12)14/h2-11,18H,1H3,(H2,20,21,23)/b19-11+ |
| InChIKey | NIWGGRGPFOQSFY-YBFXNURJSA-N |
| XLogP | 3.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|