C15H16N4OS — CID 88916841
1-[(E)-(2-methoxyphenyl)methylideneamino]-3-(4-methyl-3-pyridinyl)thiourea (PubChem CID 88916841) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-[(E)-(2-methoxyphenyl)methylideneamino]-3-(4-methyl-3-pyridinyl)thiourea.
| Compound Name | 1-[(E)-(2-methoxyphenyl)methylideneamino]-3-(4-methyl-3-pyridinyl)thiourea |
|---|---|
| PubChem CID | 88916841 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-[(E)-(2-methoxyphenyl)methylideneamino]-3-(4-methyl-3-pyridinyl)thiourea |
| SMILES | COc1ccccc1/C=N/NC(=S)Nc1cnccc1C |
| InChI | InChI=1S/C15H16N4OS/c1-11-7-8-16-10-13(11)18-15(21)19-17-9-12-5-3-4-6-14(12)20-2/h3-10H,1-2H3,(H2,18,19,21)/b17-9+ |
| InChIKey | UMNMGWUKBLHCQZ-RQZCQDPDSA-N |
| XLogP | 2.72 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|