C14H19N3O3 — CID 7372009
(3S)-1-N-(2-methoxyphenyl)piperidine-1,3-dicarboxamide (PubChem CID 7372009) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (3S)-1-N-(2-methoxyphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-(2-methoxyphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 7372009 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (3S)-1-N-(2-methoxyphenyl)piperidine-1,3-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C14H19N3O3/c1-20-12-7-3-2-6-11(12)16-14(19)17-8-4-5-10(9-17)13(15)18/h2-3,6-7,10H,4-5,8-9H2,1H3,(H2,15,18)(H,16,19)/t10-/m0/s1 |
| InChIKey | IQHVDKFVLUCUBM-JTQLQIEISA-N |
| XLogP | 1.42 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |